5-(4-Aminophenyl)-2,4-dihydro-3H-pyrazol-3-one
Catalog No: FT-0679660
CAS No: 103755-57-3
- Chemical Name: 5-(4-Aminophenyl)-2,4-dihydro-3H-pyrazol-3-one
- Molecular Formula: C9H9N3O
- Molecular Weight: 175.19
- InChI Key: GTLROTJOCPBZQQ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9N3O/c10-7-3-1-6(2-4-7)8-5-9(13)12-11-8/h1-4H,5,10H2,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 175.18700 |
| Density: | 1.41g/cm3 |
| CAS: | 103755-57-3 |
| Bolling_Point: | N/A |
| Product_Name: | 3-(4-aminophenyl)-1,4-dihydropyrazol-5-one |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C9H9N3O |
| Density: | 1.41g/cm3 |
|---|---|
| LogP: | 0.83840 |
| Refractive_Index: | 1.698 |
| FW: | 175.18700 |
| PSA: | 67.48000 |
| MF: | C9H9N3O |
| Exact_Mass: | 175.07500 |
| Warning_Statement: | P280 |
|---|---|
| Safety_Statements: | H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)